About 2-(2,2-dimethylpropyl)-N'-(4-methylcycloheptyl)propane-1,3-diamine
2-(2,2-dimethylpropyl)-N'-(4-methylcycloheptyl)propane-1,3-diamine (PubChem CID 114100507) has the molecular formula C16H34N2
and a molecular weight of 254.46 g/mol. Its IUPAC name is 2-(2,2-dimethylpropyl)-N'-(4-methylcycloheptyl)propane-1,3-diamine.
Molecular Properties
| Compound Name | 2-(2,2-dimethylpropyl)-N'-(4-methylcycloheptyl)propane-1,3-diamine |
| PubChem CID | 114100507 |
| Molecular Formula | C16H34N2 |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.27 |
| IUPAC Name | 2-(2,2-dimethylpropyl)-N'-(4-methylcycloheptyl)propane-1,3-diamine |
| SMILES | CC1CCCC(NCC(CN)CC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H34N2/c1-13-6-5-7-15(9-8-13)18-12-14(11-17)10-16(2,3)4/h13-15,18H,5-12,17H2,1-4H3 |
| InChIKey | JVZPRHRHGSIHKT-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2,2-dimethylpropyl)-N'-(4-methylcycloheptyl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-dimethylpropyl)-N'-(4-methylcycloheptyl)propane-1,3-diamine?
The IUPAC name of 2-(2,2-dimethylpropyl)-N'-(4-methylcycloheptyl)propane-1,3-diamine (CID 114100507) is 2-(2,2-dimethylpropyl)-N'-(4-methylcycloheptyl)propane-1,3-diamine.
What is the SMILES notation for 2-(2,2-dimethylpropyl)-N'-(4-methylcycloheptyl)propane-1,3-diamine?
The canonical SMILES for 2-(2,2-dimethylpropyl)-N'-(4-methylcycloheptyl)propane-1,3-diamine is CC1CCCC(NCC(CN)CC(C)(C)C)CC1.
What is the InChIKey of 2-(2,2-dimethylpropyl)-N'-(4-methylcycloheptyl)propane-1,3-diamine?
The InChIKey is JVZPRHRHGSIHKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34N2/c1-13-6-5-7-15(9-8-13)18-12-14(11-17)10-16(2,3)4/h13-15,18H,5-12,17H2,1-4H3.
What are the key properties of 2-(2,2-dimethylpropyl)-N'-(4-methylcycloheptyl)propane-1,3-diamine?
2-(2,2-dimethylpropyl)-N'-(4-methylcycloheptyl)propane-1,3-diamine has a molecular weight of 254.46 g/mol, XLogP of 3.56, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-dimethylpropyl)-N'-(4-methylcycloheptyl)propane-1,3-diamine is sourced from PubChem (CID 114100507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).