C24H37IO4Si — CID 11410168
ethenyl-[(4R,5S)-5-[(Z,3S)-1-iodopent-1-en-3-yl]oxy-7-[(4-methoxyphenyl)methoxy]hept-1-en-4-yl]oxy-dimethylsilane (PubChem CID 11410168) has the molecular formula C24H37IO4Si and a molecular weight of 544.55 g/mol. Its IUPAC name is ethenyl-[(4R,5S)-5-[(Z,3S)-1-iodopent-1-en-3-yl]oxy-7-[(4-methoxyphenyl)methoxy]hept-1-en-4-yl]oxy-dimethylsilane.
| Compound Name | ethenyl-[(4R,5S)-5-[(Z,3S)-1-iodopent-1-en-3-yl]oxy-7-[(4-methoxyphenyl)methoxy]hept-1-en-4-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11410168 |
| Molecular Formula | C24H37IO4Si |
| Molecular Weight | 544.55 g/mol |
| Exact Mass | 544.15 |
| IUPAC Name | ethenyl-[(4R,5S)-5-[(Z,3S)-1-iodopent-1-en-3-yl]oxy-7-[(4-methoxyphenyl)methoxy]hept-1-en-4-yl]oxy-dimethylsilane |
| SMILES | C=CC[C@@H](O[Si](C)(C)C=C)[C@H](CCOCc1ccc(OC)cc1)O[C@H](/C=C\I)CC |
| InChI | InChI=1S/C24H37IO4Si/c1-7-10-24(29-30(5,6)9-3)23(28-21(8-2)15-17-25)16-18-27-19-20-11-13-22(26-4)14-12-20/h7,9,11-15,17,21,23-24H,1,3,8,10,16,18-19H2,2,4-6H3/b17-15-/t21-,23-,24+/m0/s1 |
| InChIKey | DARVXECVMKSVDA-VYORFDSKSA-N |
| XLogP | 6.61 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.55 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|