C33H42O5Si — CID 11410205
(2S,5S,6S)-6-[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-phenylmethoxyethyl]-2-ethenyl-5-methoxyoxan-2-ol (PubChem CID 11410205) has the molecular formula C33H42O5Si and a molecular weight of 546.78 g/mol. Its IUPAC name is (2S,5S,6S)-6-[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-phenylmethoxyethyl]-2-ethenyl-5-methoxyoxan-2-ol.
| Compound Name | (2S,5S,6S)-6-[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-phenylmethoxyethyl]-2-ethenyl-5-methoxyoxan-2-ol |
|---|---|
| PubChem CID | 11410205 |
| Molecular Formula | C33H42O5Si |
| Molecular Weight | 546.78 g/mol |
| Exact Mass | 546.28 |
| IUPAC Name | (2S,5S,6S)-6-[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-phenylmethoxyethyl]-2-ethenyl-5-methoxyoxan-2-ol |
| SMILES | C=C[C@]1(O)CC[C@H](OC)[C@@H]([C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OCc2ccccc2)O1 |
| InChI | InChI=1S/C33H42O5Si/c1-6-33(34)23-22-29(35-5)31(38-33)30(36-24-26-16-10-7-11-17-26)25-37-39(32(2,3)4,27-18-12-8-13-19-27)28-20-14-9-15-21-28/h6-21,29-31,34H,1,22-25H2,2-5H3/t29-,30+,31-,33+/m0/s1 |
| InChIKey | OKECSITVOOGTCM-DVQSUWLUSA-N |
| XLogP | 5.22 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.78 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|