C14H26N2O — CID 114103033
N-[(2-ethylfuran-3-yl)methyl]-N'-(2-methylpropyl)propane-1,3-diamine (PubChem CID 114103033) has the molecular formula C14H26N2O and a molecular weight of 238.38 g/mol. Its IUPAC name is N-[(2-ethylfuran-3-yl)methyl]-N'-(2-methylpropyl)propane-1,3-diamine.
| Compound Name | N-[(2-ethylfuran-3-yl)methyl]-N'-(2-methylpropyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 114103033 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.38 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | N-[(2-ethylfuran-3-yl)methyl]-N'-(2-methylpropyl)propane-1,3-diamine |
| SMILES | CCc1occc1CNCCCNCC(C)C |
| InChI | InChI=1S/C14H26N2O/c1-4-14-13(6-9-17-14)11-16-8-5-7-15-10-12(2)3/h6,9,12,15-16H,4-5,7-8,10-11H2,1-3H3 |
| InChIKey | CGUWNZPKYUFVCQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 37.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|