C24H30O13S — CID 11410367
[(2S)-2-acetyloxy-2-[(2S,3R)-3-(4-methylphenyl)sulfonyl-3-[(1R,2R)-1,2,3-triacetyloxypropyl]oxiran-2-yl]ethyl] acetate (PubChem CID 11410367) has the molecular formula C24H30O13S and a molecular weight of 558.56 g/mol. Its IUPAC name is [(2S)-2-acetyloxy-2-[(2S,3R)-3-(4-methylphenyl)sulfonyl-3-[(1R,2R)-1,2,3-triacetyloxypropyl]oxiran-2-yl]ethyl] acetate.
| Compound Name | [(2S)-2-acetyloxy-2-[(2S,3R)-3-(4-methylphenyl)sulfonyl-3-[(1R,2R)-1,2,3-triacetyloxypropyl]oxiran-2-yl]ethyl] acetate |
|---|---|
| PubChem CID | 11410367 |
| Molecular Formula | C24H30O13S |
| Molecular Weight | 558.56 g/mol |
| Exact Mass | 558.14 |
| IUPAC Name | [(2S)-2-acetyloxy-2-[(2S,3R)-3-(4-methylphenyl)sulfonyl-3-[(1R,2R)-1,2,3-triacetyloxypropyl]oxiran-2-yl]ethyl] acetate |
| SMILES | CC(=O)OC[C@H](OC(C)=O)[C@@H]1O[C@@]1([C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H30O13S/c1-13-7-9-19(10-8-13)38(30,31)24(23(37-24)21(35-17(5)28)12-33-15(3)26)22(36-18(6)29)20(34-16(4)27)11-32-14(2)25/h7-10,20-23H,11-12H2,1-6H3/t20-,21+,22-,23+,24+/m1/s1 |
| InChIKey | GKCDBYWONLCGMR-KNOCVWDGSA-N |
| XLogP | 0.79 |
| TPSA | 178.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.56 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|