C26H49IO3Si — CID 11410449
diethyl-[(1S,2E,4S,5Z)-1-[(4R,5S)-4-[(2R)-4-iodobutan-2-yl]-2,2-dimethyl-1,3-dioxan-5-yl]-2,4-dimethylhepta-2,5-dienoxy]-propan-2-ylsilane (PubChem CID 11410449) has the molecular formula C26H49IO3Si and a molecular weight of 564.67 g/mol. Its IUPAC name is diethyl-[(1S,2E,4S,5Z)-1-[(4R,5S)-4-[(2R)-4-iodobutan-2-yl]-2,2-dimethyl-1,3-dioxan-5-yl]-2,4-dimethylhepta-2,5-dienoxy]-propan-2-ylsilane.
| Compound Name | diethyl-[(1S,2E,4S,5Z)-1-[(4R,5S)-4-[(2R)-4-iodobutan-2-yl]-2,2-dimethyl-1,3-dioxan-5-yl]-2,4-dimethylhepta-2,5-dienoxy]-propan-2-ylsilane |
|---|---|
| PubChem CID | 11410449 |
| Molecular Formula | C26H49IO3Si |
| Molecular Weight | 564.67 g/mol |
| Exact Mass | 564.25 |
| IUPAC Name | diethyl-[(1S,2E,4S,5Z)-1-[(4R,5S)-4-[(2R)-4-iodobutan-2-yl]-2,2-dimethyl-1,3-dioxan-5-yl]-2,4-dimethylhepta-2,5-dienoxy]-propan-2-ylsilane |
| SMILES | C/C=C\[C@H](C)/C=C(\C)[C@@H](O[Si](CC)(CC)C(C)C)[C@H]1COC(C)(C)O[C@@H]1[C@H](C)CCI |
| InChI | InChI=1S/C26H49IO3Si/c1-11-14-20(6)17-22(8)25(30-31(12-2,13-3)19(4)5)23-18-28-26(9,10)29-24(23)21(7)15-16-27/h11,14,17,19-21,23-25H,12-13,15-16,18H2,1-10H3/b14-11-,22-17+/t20-,21+,23-,24+,25+/m0/s1 |
| InChIKey | BCLIQIHSEYWLOM-UJKBBROKSA-N |
| XLogP | 8.15 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.67 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|