C14H16BrClN2O — CID 114104865
[2-(4-bromo-2-chlorophenyl)-1-(2-ethylfuran-3-yl)ethyl]hydrazine (PubChem CID 114104865) has the molecular formula C14H16BrClN2O and a molecular weight of 343.65 g/mol. Its IUPAC name is [2-(4-bromo-2-chlorophenyl)-1-(2-ethylfuran-3-yl)ethyl]hydrazine.
| Compound Name | [2-(4-bromo-2-chlorophenyl)-1-(2-ethylfuran-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 114104865 |
| Molecular Formula | C14H16BrClN2O |
| Molecular Weight | 343.65 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | [2-(4-bromo-2-chlorophenyl)-1-(2-ethylfuran-3-yl)ethyl]hydrazine |
| SMILES | CCc1occc1C(Cc1ccc(Br)cc1Cl)NN |
| InChI | InChI=1S/C14H16BrClN2O/c1-2-14-11(5-6-19-14)13(18-17)7-9-3-4-10(15)8-12(9)16/h3-6,8,13,18H,2,7,17H2,1H3 |
| InChIKey | XAFJGKYWGAGPDR-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.65 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|