C24H30Cl3NO8 — CID 11410487
[(2S,3aS,4S,5R,6S,7R,7aR)-7-(cyclohexylcarbamoyloxy)-5-methoxy-6-phenylmethoxy-2-(trichloromethyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-yl] formate (PubChem CID 11410487) has the molecular formula C24H30Cl3NO8 and a molecular weight of 566.86 g/mol. Its IUPAC name is [(2S,3aS,4S,5R,6S,7R,7aR)-7-(cyclohexylcarbamoyloxy)-5-methoxy-6-phenylmethoxy-2-(trichloromethyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-yl] formate.
| Compound Name | [(2S,3aS,4S,5R,6S,7R,7aR)-7-(cyclohexylcarbamoyloxy)-5-methoxy-6-phenylmethoxy-2-(trichloromethyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-yl] formate |
|---|---|
| PubChem CID | 11410487 |
| Molecular Formula | C24H30Cl3NO8 |
| Molecular Weight | 566.86 g/mol |
| Exact Mass | 565.10 |
| IUPAC Name | [(2S,3aS,4S,5R,6S,7R,7aR)-7-(cyclohexylcarbamoyloxy)-5-methoxy-6-phenylmethoxy-2-(trichloromethyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-yl] formate |
| SMILES | COC1[C@H](OC=O)[C@H]2O[C@H](C(Cl)(Cl)Cl)O[C@H]2[C@H](OC(=O)NC2CCCCC2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C24H30Cl3NO8/c1-31-16-17(32-12-14-8-4-2-5-9-14)20(36-23(30)28-15-10-6-3-7-11-15)21-19(18(16)33-13-29)34-22(35-21)24(25,26)27/h2,4-5,8-9,13,15-22H,3,6-7,10-12H2,1H3,(H,28,30)/t16?,17-,18-,19+,20+,21+,22-/m0/s1 |
| InChIKey | BAKWRVUSJPEAMW-FUECCUEESA-N |
| XLogP | 4.05 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.86 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|