C30H35Cl2N7O — CID 11410616
4-[[N-cyclohexyl-C-(4-pyrimidin-2-ylpiperazin-1-yl)carbonimidoyl]amino]-N-[2-(2,4-dichlorophenyl)ethyl]benzamide (PubChem CID 11410616) has the molecular formula C30H35Cl2N7O and a molecular weight of 580.56 g/mol. Its IUPAC name is 4-[[N-cyclohexyl-C-(4-pyrimidin-2-ylpiperazin-1-yl)carbonimidoyl]amino]-N-[2-(2,4-dichlorophenyl)ethyl]benzamide.
| Compound Name | 4-[[N-cyclohexyl-C-(4-pyrimidin-2-ylpiperazin-1-yl)carbonimidoyl]amino]-N-[2-(2,4-dichlorophenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 11410616 |
| Molecular Formula | C30H35Cl2N7O |
| Molecular Weight | 580.56 g/mol |
| Exact Mass | 579.23 |
| IUPAC Name | 4-[[N-cyclohexyl-C-(4-pyrimidin-2-ylpiperazin-1-yl)carbonimidoyl]amino]-N-[2-(2,4-dichlorophenyl)ethyl]benzamide |
| SMILES | O=C(NCCc1ccc(Cl)cc1Cl)c1ccc(N/C(=N/C2CCCCC2)N2CCN(c3ncccn3)CC2)cc1 |
| InChI | InChI=1S/C30H35Cl2N7O/c31-24-10-7-22(27(32)21-24)13-16-33-28(40)23-8-11-26(12-9-23)37-30(36-25-5-2-1-3-6-25)39-19-17-38(18-20-39)29-34-14-4-15-35-29/h4,7-12,14-15,21,25H,1-3,5-6,13,16-20H2,(H,33,40)(H,36,37) |
| InChIKey | DLSWARUAQKVVQG-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.56 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|