C31H50O7SSi — CID 11410801
[(2S,3R,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-7-[(4-methoxyphenyl)methoxy]-2,4-dimethylheptyl] 4-methylbenzenesulfonate (PubChem CID 11410801) has the molecular formula C31H50O7SSi and a molecular weight of 594.89 g/mol. Its IUPAC name is [(2S,3R,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-7-[(4-methoxyphenyl)methoxy]-2,4-dimethylheptyl] 4-methylbenzenesulfonate.
| Compound Name | [(2S,3R,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-7-[(4-methoxyphenyl)methoxy]-2,4-dimethylheptyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11410801 |
| Molecular Formula | C31H50O7SSi |
| Molecular Weight | 594.89 g/mol |
| Exact Mass | 594.30 |
| IUPAC Name | [(2S,3R,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-7-[(4-methoxyphenyl)methoxy]-2,4-dimethylheptyl] 4-methylbenzenesulfonate |
| SMILES | COc1ccc(COCC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@H](OC)[C@@H](C)COS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C31H50O7SSi/c1-23-11-17-28(18-12-23)39(32,33)37-21-24(2)30(35-8)25(3)29(38-40(9,10)31(4,5)6)19-20-36-22-26-13-15-27(34-7)16-14-26/h11-18,24-25,29-30H,19-22H2,1-10H3/t24-,25-,29+,30+/m0/s1 |
| InChIKey | KREHMUIESQOVPS-DARZMLDPSA-N |
| XLogP | 6.99 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.89 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|