C14H20N2S2 — CID 114108085
2-[(2,2-dimethylcyclopropyl)methylamino]-6-methylsulfanylbenzenecarbothioamide (PubChem CID 114108085) has the molecular formula C14H20N2S2 and a molecular weight of 280.46 g/mol. Its IUPAC name is 2-[(2,2-dimethylcyclopropyl)methylamino]-6-methylsulfanylbenzenecarbothioamide.
| Compound Name | 2-[(2,2-dimethylcyclopropyl)methylamino]-6-methylsulfanylbenzenecarbothioamide |
|---|---|
| PubChem CID | 114108085 |
| Molecular Formula | C14H20N2S2 |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 2-[(2,2-dimethylcyclopropyl)methylamino]-6-methylsulfanylbenzenecarbothioamide |
| SMILES | CSc1cccc(NCC2CC2(C)C)c1C(N)=S |
| InChI | InChI=1S/C14H20N2S2/c1-14(2)7-9(14)8-16-10-5-4-6-11(18-3)12(10)13(15)17/h4-6,9,16H,7-8H2,1-3H3,(H2,15,17) |
| InChIKey | SNRCOLVINGHPRD-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|