C14H20ClN3 — CID 114109149
6-chloro-2-cyclopropyl-N-[(1-ethylcyclobutyl)methyl]pyrimidin-4-amine (PubChem CID 114109149) has the molecular formula C14H20ClN3 and a molecular weight of 265.79 g/mol. Its IUPAC name is 6-chloro-2-cyclopropyl-N-[(1-ethylcyclobutyl)methyl]pyrimidin-4-amine.
| Compound Name | 6-chloro-2-cyclopropyl-N-[(1-ethylcyclobutyl)methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 114109149 |
| Molecular Formula | C14H20ClN3 |
| Molecular Weight | 265.79 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 6-chloro-2-cyclopropyl-N-[(1-ethylcyclobutyl)methyl]pyrimidin-4-amine |
| SMILES | CCC1(CNc2cc(Cl)nc(C3CC3)n2)CCC1 |
| InChI | InChI=1S/C14H20ClN3/c1-2-14(6-3-7-14)9-16-12-8-11(15)17-13(18-12)10-4-5-10/h8,10H,2-7,9H2,1H3,(H,16,17,18) |
| InChIKey | NIXFXOVIJUFOTO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.79 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |