C14H22N4O — CID 114109679
N-[(1-ethylcyclobutyl)methyl]-2-hydrazinyl-6-methylpyridine-4-carboxamide (PubChem CID 114109679) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is N-[(1-ethylcyclobutyl)methyl]-2-hydrazinyl-6-methylpyridine-4-carboxamide.
| Compound Name | N-[(1-ethylcyclobutyl)methyl]-2-hydrazinyl-6-methylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 114109679 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | N-[(1-ethylcyclobutyl)methyl]-2-hydrazinyl-6-methylpyridine-4-carboxamide |
| SMILES | CCC1(CNC(=O)c2cc(C)nc(NN)c2)CCC1 |
| InChI | InChI=1S/C14H22N4O/c1-3-14(5-4-6-14)9-16-13(19)11-7-10(2)17-12(8-11)18-15/h7-8H,3-6,9,15H2,1-2H3,(H,16,19)(H,17,18) |
| InChIKey | OSPUXRSXXICFJP-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|