C34H66O6Si2 — CID 11411046
(1S,3R,5S,6R,8S,10R,12S,13R)-6-ethenyl-6-methyl-13-tri(propan-2-yl)silyloxy-12-[2-tri(propan-2-yl)silyloxyethyl]-2,7,11-trioxatricyclo[8.4.0.03,8]tetradecan-5-ol (PubChem CID 11411046) has the molecular formula C34H66O6Si2 and a molecular weight of 627.07 g/mol. Its IUPAC name is (1S,3R,5S,6R,8S,10R,12S,13R)-6-ethenyl-6-methyl-13-tri(propan-2-yl)silyloxy-12-[2-tri(propan-2-yl)silyloxyethyl]-2,7,11-trioxatricyclo[8.4.0.03,8]tetradecan-5-ol.
| Compound Name | (1S,3R,5S,6R,8S,10R,12S,13R)-6-ethenyl-6-methyl-13-tri(propan-2-yl)silyloxy-12-[2-tri(propan-2-yl)silyloxyethyl]-2,7,11-trioxatricyclo[8.4.0.03,8]tetradecan-5-ol |
|---|---|
| PubChem CID | 11411046 |
| Molecular Formula | C34H66O6Si2 |
| Molecular Weight | 627.07 g/mol |
| Exact Mass | 626.44 |
| IUPAC Name | (1S,3R,5S,6R,8S,10R,12S,13R)-6-ethenyl-6-methyl-13-tri(propan-2-yl)silyloxy-12-[2-tri(propan-2-yl)silyloxyethyl]-2,7,11-trioxatricyclo[8.4.0.03,8]tetradecan-5-ol |
| SMILES | C=C[C@@]1(C)O[C@H]2C[C@H]3O[C@@H](CCO[Si](C(C)C)(C(C)C)C(C)C)[C@H](O[Si](C(C)C)(C(C)C)C(C)C)C[C@@H]3O[C@@H]2C[C@@H]1O |
| InChI | InChI=1S/C34H66O6Si2/c1-15-34(14)33(35)20-30-31(39-34)18-28-29(38-30)19-32(40-42(24(8)9,25(10)11)26(12)13)27(37-28)16-17-36-41(21(2)3,22(4)5)23(6)7/h15,21-33,35H,1,16-20H2,2-14H3/t27-,28+,29-,30+,31-,32+,33-,34+/m0/s1 |
| InChIKey | SAVQHRNMBBAAEF-XRYPNADBSA-N |
| XLogP | 8.54 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.07 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|