C38H39O5PS — CID 11411121
[(1R,2S,4S)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 3-oxo-2-(triphenyl-lambda5-phosphanylidene)butanoate (PubChem CID 11411121) has the molecular formula C38H39O5PS and a molecular weight of 638.77 g/mol. Its IUPAC name is [(1R,2S,4S)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 3-oxo-2-(triphenyl-lambda5-phosphanylidene)butanoate.
| Compound Name | [(1R,2S,4S)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 3-oxo-2-(triphenyl-lambda5-phosphanylidene)butanoate |
|---|---|
| PubChem CID | 11411121 |
| Molecular Formula | C38H39O5PS |
| Molecular Weight | 638.77 g/mol |
| Exact Mass | 638.23 |
| IUPAC Name | [(1R,2S,4S)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 3-oxo-2-(triphenyl-lambda5-phosphanylidene)butanoate |
| SMILES | CC(=O)C(C(=O)O[C@H]1C[C@@H]2CC[C@@]1(CS(=O)(=O)c1ccccc1)C2(C)C)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H39O5PS/c1-28(39)35(44(30-16-8-4-9-17-30,31-18-10-5-11-19-31)32-20-12-6-13-21-32)36(40)43-34-26-29-24-25-38(34,37(29,2)3)27-45(41,42)33-22-14-7-15-23-33/h4-23,29,34H,24-27H2,1-3H3/t29-,34-,38-/m0/s1 |
| InChIKey | NKYFZDIJCIAAKF-AEOVLEPASA-N |
| XLogP | 5.95 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.77 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|