About 2-N,5-dimethyl-4-N-(pyrimidin-4-ylmethyl)pyrimidine-2,4-diamine
2-N,5-dimethyl-4-N-(pyrimidin-4-ylmethyl)pyrimidine-2,4-diamine (PubChem CID 114112685) has the molecular formula C11H14N6
and a molecular weight of 230.28 g/mol. Its IUPAC name is 2-N,5-dimethyl-4-N-(pyrimidin-4-ylmethyl)pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 2-N,5-dimethyl-4-N-(pyrimidin-4-ylmethyl)pyrimidine-2,4-diamine |
| PubChem CID | 114112685 |
| Molecular Formula | C11H14N6 |
| Molecular Weight | 230.28 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 2-N,5-dimethyl-4-N-(pyrimidin-4-ylmethyl)pyrimidine-2,4-diamine |
| SMILES | CNc1ncc(C)c(NCc2ccncn2)n1 |
| InChI | InChI=1S/C11H14N6/c1-8-5-15-11(12-2)17-10(8)14-6-9-3-4-13-7-16-9/h3-5,7H,6H2,1-2H3,(H2,12,14,15,17) |
| InChIKey | YXMCELVJRDRGNE-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.28 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-N,5-dimethyl-4-N-(pyrimidin-4-ylmethyl)pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,5-dimethyl-4-N-(pyrimidin-4-ylmethyl)pyrimidine-2,4-diamine?
The IUPAC name of 2-N,5-dimethyl-4-N-(pyrimidin-4-ylmethyl)pyrimidine-2,4-diamine (CID 114112685) is 2-N,5-dimethyl-4-N-(pyrimidin-4-ylmethyl)pyrimidine-2,4-diamine.
What is the SMILES notation for 2-N,5-dimethyl-4-N-(pyrimidin-4-ylmethyl)pyrimidine-2,4-diamine?
The canonical SMILES for 2-N,5-dimethyl-4-N-(pyrimidin-4-ylmethyl)pyrimidine-2,4-diamine is CNc1ncc(C)c(NCc2ccncn2)n1.
What is the InChIKey of 2-N,5-dimethyl-4-N-(pyrimidin-4-ylmethyl)pyrimidine-2,4-diamine?
The InChIKey is YXMCELVJRDRGNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N6/c1-8-5-15-11(12-2)17-10(8)14-6-9-3-4-13-7-16-9/h3-5,7H,6H2,1-2H3,(H2,12,14,15,17).
What are the key properties of 2-N,5-dimethyl-4-N-(pyrimidin-4-ylmethyl)pyrimidine-2,4-diamine?
2-N,5-dimethyl-4-N-(pyrimidin-4-ylmethyl)pyrimidine-2,4-diamine has a molecular weight of 230.28 g/mol, XLogP of 1.23, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,5-dimethyl-4-N-(pyrimidin-4-ylmethyl)pyrimidine-2,4-diamine is sourced from PubChem (CID 114112685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).