About 2,2-diethyl-N'-[[1-(2-methoxyethyl)cyclopropyl]methyl]propane-1,3-diamine
2,2-diethyl-N'-[[1-(2-methoxyethyl)cyclopropyl]methyl]propane-1,3-diamine (PubChem CID 114112993) has the molecular formula C14H30N2O
and a molecular weight of 242.41 g/mol. Its IUPAC name is 2,2-diethyl-N'-[[1-(2-methoxyethyl)cyclopropyl]methyl]propane-1,3-diamine.
Molecular Properties
| Compound Name | 2,2-diethyl-N'-[[1-(2-methoxyethyl)cyclopropyl]methyl]propane-1,3-diamine |
| PubChem CID | 114112993 |
| Molecular Formula | C14H30N2O |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.24 |
| IUPAC Name | 2,2-diethyl-N'-[[1-(2-methoxyethyl)cyclopropyl]methyl]propane-1,3-diamine |
| SMILES | CCC(CC)(CN)CNCC1(CCOC)CC1 |
| InChI | InChI=1S/C14H30N2O/c1-4-13(5-2,10-15)11-16-12-14(6-7-14)8-9-17-3/h16H,4-12,15H2,1-3H3 |
| InChIKey | HZMFYTUZSDTCPE-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,2-diethyl-N'-[[1-(2-methoxyethyl)cyclopropyl]methyl]propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-diethyl-N'-[[1-(2-methoxyethyl)cyclopropyl]methyl]propane-1,3-diamine?
The IUPAC name of 2,2-diethyl-N'-[[1-(2-methoxyethyl)cyclopropyl]methyl]propane-1,3-diamine (CID 114112993) is 2,2-diethyl-N'-[[1-(2-methoxyethyl)cyclopropyl]methyl]propane-1,3-diamine.
What is the SMILES notation for 2,2-diethyl-N'-[[1-(2-methoxyethyl)cyclopropyl]methyl]propane-1,3-diamine?
The canonical SMILES for 2,2-diethyl-N'-[[1-(2-methoxyethyl)cyclopropyl]methyl]propane-1,3-diamine is CCC(CC)(CN)CNCC1(CCOC)CC1.
What is the InChIKey of 2,2-diethyl-N'-[[1-(2-methoxyethyl)cyclopropyl]methyl]propane-1,3-diamine?
The InChIKey is HZMFYTUZSDTCPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30N2O/c1-4-13(5-2,10-15)11-16-12-14(6-7-14)8-9-17-3/h16H,4-12,15H2,1-3H3.
What are the key properties of 2,2-diethyl-N'-[[1-(2-methoxyethyl)cyclopropyl]methyl]propane-1,3-diamine?
2,2-diethyl-N'-[[1-(2-methoxyethyl)cyclopropyl]methyl]propane-1,3-diamine has a molecular weight of 242.41 g/mol, XLogP of 2.16, 10 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-diethyl-N'-[[1-(2-methoxyethyl)cyclopropyl]methyl]propane-1,3-diamine is sourced from PubChem (CID 114112993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).