C15H24N2O — CID 114113980
1-N-(3-methyloxan-3-yl)-3-phenylpropane-1,2-diamine (PubChem CID 114113980) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is 1-N-(3-methyloxan-3-yl)-3-phenylpropane-1,2-diamine.
| Compound Name | 1-N-(3-methyloxan-3-yl)-3-phenylpropane-1,2-diamine |
|---|---|
| PubChem CID | 114113980 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 1-N-(3-methyloxan-3-yl)-3-phenylpropane-1,2-diamine |
| SMILES | CC1(NCC(N)Cc2ccccc2)CCCOC1 |
| InChI | InChI=1S/C15H24N2O/c1-15(8-5-9-18-12-15)17-11-14(16)10-13-6-3-2-4-7-13/h2-4,6-7,14,17H,5,8-12,16H2,1H3 |
| InChIKey | REDCRRFPEDKLRI-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |