C45H45O5PS — CID 11411554
[(1R,2S,4S)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 3-oxo-5-phenyl-2-(triphenyl-lambda5-phosphanylidene)pentanoate (PubChem CID 11411554) has the molecular formula C45H45O5PS and a molecular weight of 728.89 g/mol. Its IUPAC name is [(1R,2S,4S)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 3-oxo-5-phenyl-2-(triphenyl-lambda5-phosphanylidene)pentanoate.
| Compound Name | [(1R,2S,4S)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 3-oxo-5-phenyl-2-(triphenyl-lambda5-phosphanylidene)pentanoate |
|---|---|
| PubChem CID | 11411554 |
| Molecular Formula | C45H45O5PS |
| Molecular Weight | 728.89 g/mol |
| Exact Mass | 728.27 |
| IUPAC Name | [(1R,2S,4S)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 3-oxo-5-phenyl-2-(triphenyl-lambda5-phosphanylidene)pentanoate |
| SMILES | CC1(C)[C@H]2CC[C@]1(CS(=O)(=O)c1ccccc1)[C@@H](OC(=O)C(C(=O)CCc1ccccc1)=P(c1ccccc1)(c1ccccc1)c1ccccc1)C2 |
| InChI | InChI=1S/C45H45O5PS/c1-44(2)35-30-31-45(44,33-52(48,49)39-26-16-7-17-27-39)41(32-35)50-43(47)42(40(46)29-28-34-18-8-3-9-19-34)51(36-20-10-4-11-21-36,37-22-12-5-13-23-37)38-24-14-6-15-25-38/h3-27,35,41H,28-33H2,1-2H3/t35-,41-,45-/m0/s1 |
| InChIKey | LBKVHCGNHDUDKZ-ZGYCFNHPSA-N |
| XLogP | 7.57 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.89 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|