C13H21ClN2S — CID 114115597
3-chloro-1-N-(2-ethyl-2-methylsulfanylbutyl)benzene-1,2-diamine (PubChem CID 114115597) has the molecular formula C13H21ClN2S and a molecular weight of 272.84 g/mol. Its IUPAC name is 3-chloro-1-N-(2-ethyl-2-methylsulfanylbutyl)benzene-1,2-diamine.
| Compound Name | 3-chloro-1-N-(2-ethyl-2-methylsulfanylbutyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 114115597 |
| Molecular Formula | C13H21ClN2S |
| Molecular Weight | 272.84 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 3-chloro-1-N-(2-ethyl-2-methylsulfanylbutyl)benzene-1,2-diamine |
| SMILES | CCC(CC)(CNc1cccc(Cl)c1N)SC |
| InChI | InChI=1S/C13H21ClN2S/c1-4-13(5-2,17-3)9-16-11-8-6-7-10(14)12(11)15/h6-8,16H,4-5,9,15H2,1-3H3 |
| InChIKey | ABPCBXAMZYTOBY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.84 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|