C14H28N2OS — CID 114116225
2-(tert-butylamino)-N-[(1-methylsulfanylcyclohexyl)methyl]acetamide (PubChem CID 114116225) has the molecular formula C14H28N2OS and a molecular weight of 272.46 g/mol. Its IUPAC name is 2-(tert-butylamino)-N-[(1-methylsulfanylcyclohexyl)methyl]acetamide.
| Compound Name | 2-(tert-butylamino)-N-[(1-methylsulfanylcyclohexyl)methyl]acetamide |
|---|---|
| PubChem CID | 114116225 |
| Molecular Formula | C14H28N2OS |
| Molecular Weight | 272.46 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 2-(tert-butylamino)-N-[(1-methylsulfanylcyclohexyl)methyl]acetamide |
| SMILES | CSC1(CNC(=O)CNC(C)(C)C)CCCCC1 |
| InChI | InChI=1S/C14H28N2OS/c1-13(2,3)16-10-12(17)15-11-14(18-4)8-6-5-7-9-14/h16H,5-11H2,1-4H3,(H,15,17) |
| InChIKey | KBHRYBKDUKGGGQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.46 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |