C14H23NO4 — CID 114117925
1-[2-[(3-methoxycyclopentyl)amino]-2-oxoethyl]cyclopentane-1-carboxylic acid (PubChem CID 114117925) has the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. Its IUPAC name is 1-[2-[(3-methoxycyclopentyl)amino]-2-oxoethyl]cyclopentane-1-carboxylic acid.
| Compound Name | 1-[2-[(3-methoxycyclopentyl)amino]-2-oxoethyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 114117925 |
| Molecular Formula | C14H23NO4 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 1-[2-[(3-methoxycyclopentyl)amino]-2-oxoethyl]cyclopentane-1-carboxylic acid |
| SMILES | COC1CCC(NC(=O)CC2(C(=O)O)CCCC2)C1 |
| InChI | InChI=1S/C14H23NO4/c1-19-11-5-4-10(8-11)15-12(16)9-14(13(17)18)6-2-3-7-14/h10-11H,2-9H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | OQNQIRUKCZXPKP-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |