C14H16N2O3 — CID 114118188
3-(3-methoxycyclopentyl)benzimidazole-5-carboxylic acid (PubChem CID 114118188) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is 3-(3-methoxycyclopentyl)benzimidazole-5-carboxylic acid.
| Compound Name | 3-(3-methoxycyclopentyl)benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 114118188 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 3-(3-methoxycyclopentyl)benzimidazole-5-carboxylic acid |
| SMILES | COC1CCC(n2cnc3ccc(C(=O)O)cc32)C1 |
| InChI | InChI=1S/C14H16N2O3/c1-19-11-4-3-10(7-11)16-8-15-12-5-2-9(14(17)18)6-13(12)16/h2,5-6,8,10-11H,3-4,7H2,1H3,(H,17,18) |
| InChIKey | PVGQTYDKNSPJER-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |