About 4-amino-N-(3-methoxy-2,2-dimethylcyclobutyl)-1H-pyrrole-2-carboxamide
4-amino-N-(3-methoxy-2,2-dimethylcyclobutyl)-1H-pyrrole-2-carboxamide (PubChem CID 114118438) has the molecular formula C12H19N3O2
and a molecular weight of 237.30 g/mol. Its IUPAC name is 4-amino-N-(3-methoxy-2,2-dimethylcyclobutyl)-1H-pyrrole-2-carboxamide.
Molecular Properties
| Compound Name | 4-amino-N-(3-methoxy-2,2-dimethylcyclobutyl)-1H-pyrrole-2-carboxamide |
| PubChem CID | 114118438 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 4-amino-N-(3-methoxy-2,2-dimethylcyclobutyl)-1H-pyrrole-2-carboxamide |
| SMILES | COC1CC(NC(=O)c2cc(N)c[nH]2)C1(C)C |
| InChI | InChI=1S/C12H19N3O2/c1-12(2)9(5-10(12)17-3)15-11(16)8-4-7(13)6-14-8/h4,6,9-10,14H,5,13H2,1-3H3,(H,15,16) |
| InChIKey | GYPSLLOKXQEKAZ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 80.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-amino-N-(3-methoxy-2,2-dimethylcyclobutyl)-1H-pyrrole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N-(3-methoxy-2,2-dimethylcyclobutyl)-1H-pyrrole-2-carboxamide?
The IUPAC name of 4-amino-N-(3-methoxy-2,2-dimethylcyclobutyl)-1H-pyrrole-2-carboxamide (CID 114118438) is 4-amino-N-(3-methoxy-2,2-dimethylcyclobutyl)-1H-pyrrole-2-carboxamide.
What is the SMILES notation for 4-amino-N-(3-methoxy-2,2-dimethylcyclobutyl)-1H-pyrrole-2-carboxamide?
The canonical SMILES for 4-amino-N-(3-methoxy-2,2-dimethylcyclobutyl)-1H-pyrrole-2-carboxamide is COC1CC(NC(=O)c2cc(N)c[nH]2)C1(C)C.
What is the InChIKey of 4-amino-N-(3-methoxy-2,2-dimethylcyclobutyl)-1H-pyrrole-2-carboxamide?
The InChIKey is GYPSLLOKXQEKAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O2/c1-12(2)9(5-10(12)17-3)15-11(16)8-4-7(13)6-14-8/h4,6,9-10,14H,5,13H2,1-3H3,(H,15,16).
What are the key properties of 4-amino-N-(3-methoxy-2,2-dimethylcyclobutyl)-1H-pyrrole-2-carboxamide?
4-amino-N-(3-methoxy-2,2-dimethylcyclobutyl)-1H-pyrrole-2-carboxamide has a molecular weight of 237.30 g/mol, XLogP of 1.14, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-(3-methoxy-2,2-dimethylcyclobutyl)-1H-pyrrole-2-carboxamide is sourced from PubChem (CID 114118438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).