C14H30N2O — CID 114119731
N'-(3-methoxy-2,2-dimethylcyclobutyl)heptane-1,7-diamine (PubChem CID 114119731) has the molecular formula C14H30N2O and a molecular weight of 242.41 g/mol. Its IUPAC name is N'-(3-methoxy-2,2-dimethylcyclobutyl)heptane-1,7-diamine.
| Compound Name | N'-(3-methoxy-2,2-dimethylcyclobutyl)heptane-1,7-diamine |
|---|---|
| PubChem CID | 114119731 |
| Molecular Formula | C14H30N2O |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.24 |
| IUPAC Name | N'-(3-methoxy-2,2-dimethylcyclobutyl)heptane-1,7-diamine |
| SMILES | COC1CC(NCCCCCCCN)C1(C)C |
| InChI | InChI=1S/C14H30N2O/c1-14(2)12(11-13(14)17-3)16-10-8-6-4-5-7-9-15/h12-13,16H,4-11,15H2,1-3H3 |
| InChIKey | CARHFOSFBDCQNT-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|