About N-(3-methoxy-2,2-dimethylcyclobutyl)-2-(propan-2-ylamino)ethanesulfonamide
N-(3-methoxy-2,2-dimethylcyclobutyl)-2-(propan-2-ylamino)ethanesulfonamide (PubChem CID 114120022) has the molecular formula C12H26N2O3S
and a molecular weight of 278.42 g/mol. Its IUPAC name is N-(3-methoxy-2,2-dimethylcyclobutyl)-2-(propan-2-ylamino)ethanesulfonamide.
Molecular Properties
| Compound Name | N-(3-methoxy-2,2-dimethylcyclobutyl)-2-(propan-2-ylamino)ethanesulfonamide |
| PubChem CID | 114120022 |
| Molecular Formula | C12H26N2O3S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | N-(3-methoxy-2,2-dimethylcyclobutyl)-2-(propan-2-ylamino)ethanesulfonamide |
| SMILES | COC1CC(NS(=O)(=O)CCNC(C)C)C1(C)C |
| InChI | InChI=1S/C12H26N2O3S/c1-9(2)13-6-7-18(15,16)14-10-8-11(17-5)12(10,3)4/h9-11,13-14H,6-8H2,1-5H3 |
| InChIKey | FWFWMFDRICTVDD-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3-methoxy-2,2-dimethylcyclobutyl)-2-(propan-2-ylamino)ethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methoxy-2,2-dimethylcyclobutyl)-2-(propan-2-ylamino)ethanesulfonamide?
The IUPAC name of N-(3-methoxy-2,2-dimethylcyclobutyl)-2-(propan-2-ylamino)ethanesulfonamide (CID 114120022) is N-(3-methoxy-2,2-dimethylcyclobutyl)-2-(propan-2-ylamino)ethanesulfonamide.
What is the SMILES notation for N-(3-methoxy-2,2-dimethylcyclobutyl)-2-(propan-2-ylamino)ethanesulfonamide?
The canonical SMILES for N-(3-methoxy-2,2-dimethylcyclobutyl)-2-(propan-2-ylamino)ethanesulfonamide is COC1CC(NS(=O)(=O)CCNC(C)C)C1(C)C.
What is the InChIKey of N-(3-methoxy-2,2-dimethylcyclobutyl)-2-(propan-2-ylamino)ethanesulfonamide?
The InChIKey is FWFWMFDRICTVDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N2O3S/c1-9(2)13-6-7-18(15,16)14-10-8-11(17-5)12(10,3)4/h9-11,13-14H,6-8H2,1-5H3.
What are the key properties of N-(3-methoxy-2,2-dimethylcyclobutyl)-2-(propan-2-ylamino)ethanesulfonamide?
N-(3-methoxy-2,2-dimethylcyclobutyl)-2-(propan-2-ylamino)ethanesulfonamide has a molecular weight of 278.42 g/mol, XLogP of 0.72, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methoxy-2,2-dimethylcyclobutyl)-2-(propan-2-ylamino)ethanesulfonamide is sourced from PubChem (CID 114120022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).