C11H15FN2O4 — CID 114120604
5-fluoro-1-(3-methoxy-2,2-dimethylcyclobutyl)-1,3-diazinane-2,4,6-trione (PubChem CID 114120604) has the molecular formula C11H15FN2O4 and a molecular weight of 258.25 g/mol. Its IUPAC name is 5-fluoro-1-(3-methoxy-2,2-dimethylcyclobutyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-fluoro-1-(3-methoxy-2,2-dimethylcyclobutyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 114120604 |
| Molecular Formula | C11H15FN2O4 |
| Molecular Weight | 258.25 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 5-fluoro-1-(3-methoxy-2,2-dimethylcyclobutyl)-1,3-diazinane-2,4,6-trione |
| SMILES | COC1CC(N2C(=O)NC(=O)C(F)C2=O)C1(C)C |
| InChI | InChI=1S/C11H15FN2O4/c1-11(2)5(4-6(11)18-3)14-9(16)7(12)8(15)13-10(14)17/h5-7H,4H2,1-3H3,(H,13,15,17) |
| InChIKey | MMUHIPWJTJCUTF-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.25 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|