C11H16N2O4 — CID 114120625
1-(3-methoxycyclobutyl)-5,5-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 114120625) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is 1-(3-methoxycyclobutyl)-5,5-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-(3-methoxycyclobutyl)-5,5-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 114120625 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 1-(3-methoxycyclobutyl)-5,5-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | COC1CC(N2C(=O)NC(=O)C(C)(C)C2=O)C1 |
| InChI | InChI=1S/C11H16N2O4/c1-11(2)8(14)12-10(16)13(9(11)15)6-4-7(5-6)17-3/h6-7H,4-5H2,1-3H3,(H,12,14,16) |
| InChIKey | OWCWFLPUVNEORC-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|