About (1R)-1-[3-(3-ethoxy-2,2-dimethylcyclobutyl)imidazol-4-yl]ethanamine
(1R)-1-[3-(3-ethoxy-2,2-dimethylcyclobutyl)imidazol-4-yl]ethanamine (PubChem CID 114120917) has the molecular formula C13H23N3O
and a molecular weight of 237.35 g/mol. Its IUPAC name is (1R)-1-[3-(3-ethoxy-2,2-dimethylcyclobutyl)imidazol-4-yl]ethanamine.
Molecular Properties
| Compound Name | (1R)-1-[3-(3-ethoxy-2,2-dimethylcyclobutyl)imidazol-4-yl]ethanamine |
| PubChem CID | 114120917 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | (1R)-1-[3-(3-ethoxy-2,2-dimethylcyclobutyl)imidazol-4-yl]ethanamine |
| SMILES | CCOC1CC(n2cncc2[C@@H](C)N)C1(C)C |
| InChI | InChI=1S/C13H23N3O/c1-5-17-12-6-11(13(12,3)4)16-8-15-7-10(16)9(2)14/h7-9,11-12H,5-6,14H2,1-4H3/t9-,11?,12?/m1/s1 |
| InChIKey | NYPPOVNWLCFVGP-OIKLOGQESA-N |
| XLogP | 2.28 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1R)-1-[3-(3-ethoxy-2,2-dimethylcyclobutyl)imidazol-4-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-[3-(3-ethoxy-2,2-dimethylcyclobutyl)imidazol-4-yl]ethanamine?
The IUPAC name of (1R)-1-[3-(3-ethoxy-2,2-dimethylcyclobutyl)imidazol-4-yl]ethanamine (CID 114120917) is (1R)-1-[3-(3-ethoxy-2,2-dimethylcyclobutyl)imidazol-4-yl]ethanamine.
What is the SMILES notation for (1R)-1-[3-(3-ethoxy-2,2-dimethylcyclobutyl)imidazol-4-yl]ethanamine?
The canonical SMILES for (1R)-1-[3-(3-ethoxy-2,2-dimethylcyclobutyl)imidazol-4-yl]ethanamine is CCOC1CC(n2cncc2[C@@H](C)N)C1(C)C.
What is the InChIKey of (1R)-1-[3-(3-ethoxy-2,2-dimethylcyclobutyl)imidazol-4-yl]ethanamine?
The InChIKey is NYPPOVNWLCFVGP-OIKLOGQESA-N. The full InChI is InChI=1S/C13H23N3O/c1-5-17-12-6-11(13(12,3)4)16-8-15-7-10(16)9(2)14/h7-9,11-12H,5-6,14H2,1-4H3/t9-,11?,12?/m1/s1.
What are the key properties of (1R)-1-[3-(3-ethoxy-2,2-dimethylcyclobutyl)imidazol-4-yl]ethanamine?
(1R)-1-[3-(3-ethoxy-2,2-dimethylcyclobutyl)imidazol-4-yl]ethanamine has a molecular weight of 237.35 g/mol, XLogP of 2.28, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-[3-(3-ethoxy-2,2-dimethylcyclobutyl)imidazol-4-yl]ethanamine is sourced from PubChem (CID 114120917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).