C52H72F6NO10P — CID 11412093
bis[[4-(hex-5-enoxymethyl)phenyl]methyl]azanium;2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12,14,16,28,30-hexaene;hexafluorophosphate (PubChem CID 11412093) has the molecular formula C52H72F6NO10P and a molecular weight of 1016.11 g/mol. Its IUPAC name is bis[[4-(hex-5-enoxymethyl)phenyl]methyl]azanium;2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12,14,16,28,30-hexaene;hexafluorophosphate.
| Compound Name | bis[[4-(hex-5-enoxymethyl)phenyl]methyl]azanium;2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12,14,16,28,30-hexaene;hexafluorophosphate |
|---|---|
| PubChem CID | 11412093 |
| Molecular Formula | C52H72F6NO10P |
| Molecular Weight | 1016.11 g/mol |
| Exact Mass | 1015.48 |
| IUPAC Name | bis[[4-(hex-5-enoxymethyl)phenyl]methyl]azanium;2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12,14,16,28,30-hexaene;hexafluorophosphate |
| SMILES | C=CCCCCOCc1ccc(C[NH2+]Cc2ccc(COCCCCC=C)cc2)cc1.F[P-](F)(F)(F)(F)F.c1ccc2c(c1)OCCOCCOCCOc1ccccc1OCCOCCOCCO2 |
| InChI | InChI=1S/C28H39NO2.C24H32O8.F6P/c1-3-5-7-9-19-30-23-27-15-11-25(12-16-27)21-29-22-26-13-17-28(18-14-26)24-31-20-10-8-6-4-2;1-2-6-22-21(5-1)29-17-13-25-9-10-27-15-19-31-23-7-3-4-8-24(23)32-20-16-28-12-11-26-14-18-30-22;1-7(2,3,4,5)6/h3-4,11-18,29H,1-2,5-10,19-24H2;1-8H,9-20H2;/q;;-1/p+1 |
| InChIKey | BQBJBOOPZZIOIC-UHFFFAOYSA-O |
| XLogP | 12.06 |
| TPSA | 108.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1016.11 |
| LogP ≤ 5 | 12.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|