C13H19N3S2 — CID 114121610
5-[(2-ethylsulfanylcyclopentyl)amino]pyridine-2-carbothioamide (PubChem CID 114121610) has the molecular formula C13H19N3S2 and a molecular weight of 281.45 g/mol. Its IUPAC name is 5-[(2-ethylsulfanylcyclopentyl)amino]pyridine-2-carbothioamide.
| Compound Name | 5-[(2-ethylsulfanylcyclopentyl)amino]pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 114121610 |
| Molecular Formula | C13H19N3S2 |
| Molecular Weight | 281.45 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 5-[(2-ethylsulfanylcyclopentyl)amino]pyridine-2-carbothioamide |
| SMILES | CCSC1CCCC1Nc1ccc(C(N)=S)nc1 |
| InChI | InChI=1S/C13H19N3S2/c1-2-18-12-5-3-4-10(12)16-9-6-7-11(13(14)17)15-8-9/h6-8,10,12,16H,2-5H2,1H3,(H2,14,17) |
| InChIKey | NCSLOVMWLWKCNT-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.45 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|