About 1-oxaspiro[4.4]non-8-ene
1-oxaspiro[4.4]non-8-ene (PubChem CID 11412372) has the molecular formula C8H12O
and a molecular weight of 124.18 g/mol. Its IUPAC name is 1-oxaspiro[4.4]non-8-ene.
Molecular Properties
| Compound Name | 1-oxaspiro[4.4]non-8-ene |
| PubChem CID | 11412372 |
| Molecular Formula | C8H12O |
| Molecular Weight | 124.18 g/mol |
| Exact Mass | 124.09 |
| IUPAC Name | 1-oxaspiro[4.4]non-8-ene |
| SMILES | C1=CC2(CC1)CCCO2 |
| InChI | InChI=1S/C8H12O/c1-2-5-8(4-1)6-3-7-9-8/h1,4H,2-3,5-7H2 |
| InChIKey | BFJMHXGFLCMQIV-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.18 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-oxaspiro[4.4]non-8-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxaspiro[4.4]non-8-ene?
The IUPAC name of 1-oxaspiro[4.4]non-8-ene (CID 11412372) is 1-oxaspiro[4.4]non-8-ene.
What is the SMILES notation for 1-oxaspiro[4.4]non-8-ene?
The canonical SMILES for 1-oxaspiro[4.4]non-8-ene is C1=CC2(CC1)CCCO2.
What is the InChIKey of 1-oxaspiro[4.4]non-8-ene?
The InChIKey is BFJMHXGFLCMQIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O/c1-2-5-8(4-1)6-3-7-9-8/h1,4H,2-3,5-7H2.
What are the key properties of 1-oxaspiro[4.4]non-8-ene?
1-oxaspiro[4.4]non-8-ene has a molecular weight of 124.18 g/mol, XLogP of 1.89, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxaspiro[4.4]non-8-ene is sourced from PubChem (CID 11412372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).