C12H22N2O3S — CID 114123994
2-[methyl-[(3-methylsulfanylcyclopentyl)carbamoyl]amino]butanoic acid (PubChem CID 114123994) has the molecular formula C12H22N2O3S and a molecular weight of 274.39 g/mol. Its IUPAC name is 2-[methyl-[(3-methylsulfanylcyclopentyl)carbamoyl]amino]butanoic acid.
| Compound Name | 2-[methyl-[(3-methylsulfanylcyclopentyl)carbamoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 114123994 |
| Molecular Formula | C12H22N2O3S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 2-[methyl-[(3-methylsulfanylcyclopentyl)carbamoyl]amino]butanoic acid |
| SMILES | CCC(C(=O)O)N(C)C(=O)NC1CCC(SC)C1 |
| InChI | InChI=1S/C12H22N2O3S/c1-4-10(11(15)16)14(2)12(17)13-8-5-6-9(7-8)18-3/h8-10H,4-7H2,1-3H3,(H,13,17)(H,15,16) |
| InChIKey | DJPALSPLVDTOKO-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |