About 2-amino-2-[2-[(3-ethylsulfanylcyclopentyl)amino]-1,3-thiazol-4-yl]acetic acid
2-amino-2-[2-[(3-ethylsulfanylcyclopentyl)amino]-1,3-thiazol-4-yl]acetic acid (PubChem CID 114124359) has the molecular formula C12H19N3O2S2
and a molecular weight of 301.44 g/mol. Its IUPAC name is 2-amino-2-[2-[(3-ethylsulfanylcyclopentyl)amino]-1,3-thiazol-4-yl]acetic acid.
Molecular Properties
| Compound Name | 2-amino-2-[2-[(3-ethylsulfanylcyclopentyl)amino]-1,3-thiazol-4-yl]acetic acid |
| PubChem CID | 114124359 |
| Molecular Formula | C12H19N3O2S2 |
| Molecular Weight | 301.44 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 2-amino-2-[2-[(3-ethylsulfanylcyclopentyl)amino]-1,3-thiazol-4-yl]acetic acid |
| SMILES | CCSC1CCC(Nc2nc(C(N)C(=O)O)cs2)C1 |
| InChI | InChI=1S/C12H19N3O2S2/c1-2-18-8-4-3-7(5-8)14-12-15-9(6-19-12)10(13)11(16)17/h6-8,10H,2-5,13H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | BGTYKQUIUGSTQO-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.44 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-amino-2-[2-[(3-ethylsulfanylcyclopentyl)amino]-1,3-thiazol-4-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-[2-[(3-ethylsulfanylcyclopentyl)amino]-1,3-thiazol-4-yl]acetic acid?
The IUPAC name of 2-amino-2-[2-[(3-ethylsulfanylcyclopentyl)amino]-1,3-thiazol-4-yl]acetic acid (CID 114124359) is 2-amino-2-[2-[(3-ethylsulfanylcyclopentyl)amino]-1,3-thiazol-4-yl]acetic acid.
What is the SMILES notation for 2-amino-2-[2-[(3-ethylsulfanylcyclopentyl)amino]-1,3-thiazol-4-yl]acetic acid?
The canonical SMILES for 2-amino-2-[2-[(3-ethylsulfanylcyclopentyl)amino]-1,3-thiazol-4-yl]acetic acid is CCSC1CCC(Nc2nc(C(N)C(=O)O)cs2)C1.
What is the InChIKey of 2-amino-2-[2-[(3-ethylsulfanylcyclopentyl)amino]-1,3-thiazol-4-yl]acetic acid?
The InChIKey is BGTYKQUIUGSTQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O2S2/c1-2-18-8-4-3-7(5-8)14-12-15-9(6-19-12)10(13)11(16)17/h6-8,10H,2-5,13H2,1H3,(H,14,15)(H,16,17).
What are the key properties of 2-amino-2-[2-[(3-ethylsulfanylcyclopentyl)amino]-1,3-thiazol-4-yl]acetic acid?
2-amino-2-[2-[(3-ethylsulfanylcyclopentyl)amino]-1,3-thiazol-4-yl]acetic acid has a molecular weight of 301.44 g/mol, XLogP of 2.31, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-[2-[(3-ethylsulfanylcyclopentyl)amino]-1,3-thiazol-4-yl]acetic acid is sourced from PubChem (CID 114124359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).