C12H24N2O2S2 — CID 114125521
2-[(1-ethylcyclopentyl)methylsulfamoyl]butanethioamide (PubChem CID 114125521) has the molecular formula C12H24N2O2S2 and a molecular weight of 292.47 g/mol. Its IUPAC name is 2-[(1-ethylcyclopentyl)methylsulfamoyl]butanethioamide.
| Compound Name | 2-[(1-ethylcyclopentyl)methylsulfamoyl]butanethioamide |
|---|---|
| PubChem CID | 114125521 |
| Molecular Formula | C12H24N2O2S2 |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 2-[(1-ethylcyclopentyl)methylsulfamoyl]butanethioamide |
| SMILES | CCC(C(N)=S)S(=O)(=O)NCC1(CC)CCCC1 |
| InChI | InChI=1S/C12H24N2O2S2/c1-3-10(11(13)17)18(15,16)14-9-12(4-2)7-5-6-8-12/h10,14H,3-9H2,1-2H3,(H2,13,17) |
| InChIKey | OHTATFPVVWMKOW-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|