C20H18F3N5O2 — CID 1141256
(5R,7S)-5-(3-methoxyphenyl)-N-pyridin-3-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 1141256) has the molecular formula C20H18F3N5O2 and a molecular weight of 417.39 g/mol. Its IUPAC name is (5R,7S)-5-(3-methoxyphenyl)-N-pyridin-3-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | (5R,7S)-5-(3-methoxyphenyl)-N-pyridin-3-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 1141256 |
| Molecular Formula | C20H18F3N5O2 |
| Molecular Weight | 417.39 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | (5R,7S)-5-(3-methoxyphenyl)-N-pyridin-3-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | COc1cccc([C@H]2C[C@@H](C(F)(F)F)n3ncc(C(=O)Nc4cccnc4)c3N2)c1 |
| InChI | InChI=1S/C20H18F3N5O2/c1-30-14-6-2-4-12(8-14)16-9-17(20(21,22)23)28-18(27-16)15(11-25-28)19(29)26-13-5-3-7-24-10-13/h2-8,10-11,16-17,27H,9H2,1H3,(H,26,29)/t16-,17+/m1/s1 |
| InChIKey | DSYAQDWOJUXISK-SJORKVTESA-N |
| XLogP | 4.20 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.39 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |