C10H12O2 — CID 11412574
(1S,2S,6S,7R,10S)-10-hydroxytricyclo[5.2.1.02,6]dec-8-en-3-one (PubChem CID 11412574) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is (1S,2S,6S,7R,10S)-10-hydroxytricyclo[5.2.1.02,6]dec-8-en-3-one.
| Compound Name | (1S,2S,6S,7R,10S)-10-hydroxytricyclo[5.2.1.02,6]dec-8-en-3-one |
|---|---|
| PubChem CID | 11412574 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | (1S,2S,6S,7R,10S)-10-hydroxytricyclo[5.2.1.02,6]dec-8-en-3-one |
| SMILES | O=C1CC[C@H]2[C@H]3C=C[C@H]([C@H]3O)[C@@H]12 |
| InChI | InChI=1S/C10H12O2/c11-8-4-3-5-6-1-2-7(9(5)8)10(6)12/h1-2,5-7,9-10,12H,3-4H2/t5-,6+,7-,9-,10-/m0/s1 |
| InChIKey | JMYRTKFPUSIMKY-ZVKZPEPKSA-N |
| XLogP | 0.76 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|