C9H8FNO — CID 11412578
2-(3-fluorophenyl)-4,5-dihydro-1,3-oxazole (PubChem CID 11412578) has the molecular formula C9H8FNO and a molecular weight of 165.17 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-4,5-dihydro-1,3-oxazole.
| Compound Name | 2-(3-fluorophenyl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 11412578 |
| Molecular Formula | C9H8FNO |
| Molecular Weight | 165.17 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | 2-(3-fluorophenyl)-4,5-dihydro-1,3-oxazole |
| SMILES | Fc1cccc(C2=NCCO2)c1 |
| InChI | InChI=1S/C9H8FNO/c10-8-3-1-2-7(6-8)9-11-4-5-12-9/h1-3,6H,4-5H2 |
| InChIKey | RHHRXGQPLKIQGQ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.17 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |