C14H20BrNO3 — CID 114126373
5-bromo-2-[(4-methoxy-2,2-dimethylbutyl)amino]benzoic acid (PubChem CID 114126373) has the molecular formula C14H20BrNO3 and a molecular weight of 330.22 g/mol. Its IUPAC name is 5-bromo-2-[(4-methoxy-2,2-dimethylbutyl)amino]benzoic acid.
| Compound Name | 5-bromo-2-[(4-methoxy-2,2-dimethylbutyl)amino]benzoic acid |
|---|---|
| PubChem CID | 114126373 |
| Molecular Formula | C14H20BrNO3 |
| Molecular Weight | 330.22 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 5-bromo-2-[(4-methoxy-2,2-dimethylbutyl)amino]benzoic acid |
| SMILES | COCCC(C)(C)CNc1ccc(Br)cc1C(=O)O |
| InChI | InChI=1S/C14H20BrNO3/c1-14(2,6-7-19-3)9-16-12-5-4-10(15)8-11(12)13(17)18/h4-5,8,16H,6-7,9H2,1-3H3,(H,17,18) |
| InChIKey | NDAGGMGUZGJNHU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.22 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |