About 2-[(E)-1-fluoro-3-methylbut-1-enyl]-4,5-dihydro-1,3-thiazole
2-[(E)-1-fluoro-3-methylbut-1-enyl]-4,5-dihydro-1,3-thiazole (PubChem CID 11412655) has the molecular formula C8H12FNS
and a molecular weight of 173.26 g/mol. Its IUPAC name is 2-[(E)-1-fluoro-3-methylbut-1-enyl]-4,5-dihydro-1,3-thiazole.
Molecular Properties
| Compound Name | 2-[(E)-1-fluoro-3-methylbut-1-enyl]-4,5-dihydro-1,3-thiazole |
| PubChem CID | 11412655 |
| Molecular Formula | C8H12FNS |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | 2-[(E)-1-fluoro-3-methylbut-1-enyl]-4,5-dihydro-1,3-thiazole |
| SMILES | CC(C)/C=C(/F)C1=NCCS1 |
| InChI | InChI=1S/C8H12FNS/c1-6(2)5-7(9)8-10-3-4-11-8/h5-6H,3-4H2,1-2H3/b7-5+ |
| InChIKey | NBRYIWCCLYXOQF-FNORWQNLSA-N |
| XLogP | 2.64 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(E)-1-fluoro-3-methylbut-1-enyl]-4,5-dihydro-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-1-fluoro-3-methylbut-1-enyl]-4,5-dihydro-1,3-thiazole?
The IUPAC name of 2-[(E)-1-fluoro-3-methylbut-1-enyl]-4,5-dihydro-1,3-thiazole (CID 11412655) is 2-[(E)-1-fluoro-3-methylbut-1-enyl]-4,5-dihydro-1,3-thiazole.
What is the SMILES notation for 2-[(E)-1-fluoro-3-methylbut-1-enyl]-4,5-dihydro-1,3-thiazole?
The canonical SMILES for 2-[(E)-1-fluoro-3-methylbut-1-enyl]-4,5-dihydro-1,3-thiazole is CC(C)/C=C(/F)C1=NCCS1.
What is the InChIKey of 2-[(E)-1-fluoro-3-methylbut-1-enyl]-4,5-dihydro-1,3-thiazole?
The InChIKey is NBRYIWCCLYXOQF-FNORWQNLSA-N. The full InChI is InChI=1S/C8H12FNS/c1-6(2)5-7(9)8-10-3-4-11-8/h5-6H,3-4H2,1-2H3/b7-5+.
What are the key properties of 2-[(E)-1-fluoro-3-methylbut-1-enyl]-4,5-dihydro-1,3-thiazole?
2-[(E)-1-fluoro-3-methylbut-1-enyl]-4,5-dihydro-1,3-thiazole has a molecular weight of 173.26 g/mol, XLogP of 2.64, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-1-fluoro-3-methylbut-1-enyl]-4,5-dihydro-1,3-thiazole is sourced from PubChem (CID 11412655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).