C12H16O — CID 11412678
(1S,4S)-4-ethyl-1,2,3,4-tetrahydronaphthalen-1-ol (PubChem CID 11412678) has the molecular formula C12H16O and a molecular weight of 176.26 g/mol. Its IUPAC name is (1S,4S)-4-ethyl-1,2,3,4-tetrahydronaphthalen-1-ol.
| Compound Name | (1S,4S)-4-ethyl-1,2,3,4-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 11412678 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | (1S,4S)-4-ethyl-1,2,3,4-tetrahydronaphthalen-1-ol |
| SMILES | CC[C@H]1CC[C@H](O)c2ccccc21 |
| InChI | InChI=1S/C12H16O/c1-2-9-7-8-12(13)11-6-4-3-5-10(9)11/h3-6,9,12-13H,2,7-8H2,1H3/t9-,12-/m0/s1 |
| InChIKey | UVWLLTGLHABUGJ-CABZTGNLSA-N |
| XLogP | 3.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |