About 6-bromo-3-[2-(2,2-difluoroethoxy)ethyl]-1H-imidazo[4,5-b]pyridine-2-thione
6-bromo-3-[2-(2,2-difluoroethoxy)ethyl]-1H-imidazo[4,5-b]pyridine-2-thione (PubChem CID 114126816) has the molecular formula C10H10BrF2N3OS
and a molecular weight of 338.18 g/mol. Its IUPAC name is 6-bromo-3-[2-(2,2-difluoroethoxy)ethyl]-1H-imidazo[4,5-b]pyridine-2-thione.
Molecular Properties
| Compound Name | 6-bromo-3-[2-(2,2-difluoroethoxy)ethyl]-1H-imidazo[4,5-b]pyridine-2-thione |
| PubChem CID | 114126816 |
| Molecular Formula | C10H10BrF2N3OS |
| Molecular Weight | 338.18 g/mol |
| Exact Mass | 336.97 |
| IUPAC Name | 6-bromo-3-[2-(2,2-difluoroethoxy)ethyl]-1H-imidazo[4,5-b]pyridine-2-thione |
| SMILES | FC(F)COCCn1c(=S)[nH]c2cc(Br)cnc21 |
| InChI | InChI=1S/C10H10BrF2N3OS/c11-6-3-7-9(14-4-6)16(10(18)15-7)1-2-17-5-8(12)13/h3-4,8H,1-2,5H2,(H,15,18) |
| InChIKey | AZCRPYFNFQKSHO-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.18 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-3-[2-(2,2-difluoroethoxy)ethyl]-1H-imidazo[4,5-b]pyridine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-3-[2-(2,2-difluoroethoxy)ethyl]-1H-imidazo[4,5-b]pyridine-2-thione?
The IUPAC name of 6-bromo-3-[2-(2,2-difluoroethoxy)ethyl]-1H-imidazo[4,5-b]pyridine-2-thione (CID 114126816) is 6-bromo-3-[2-(2,2-difluoroethoxy)ethyl]-1H-imidazo[4,5-b]pyridine-2-thione.
What is the SMILES notation for 6-bromo-3-[2-(2,2-difluoroethoxy)ethyl]-1H-imidazo[4,5-b]pyridine-2-thione?
The canonical SMILES for 6-bromo-3-[2-(2,2-difluoroethoxy)ethyl]-1H-imidazo[4,5-b]pyridine-2-thione is FC(F)COCCn1c(=S)[nH]c2cc(Br)cnc21.
What is the InChIKey of 6-bromo-3-[2-(2,2-difluoroethoxy)ethyl]-1H-imidazo[4,5-b]pyridine-2-thione?
The InChIKey is AZCRPYFNFQKSHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BrF2N3OS/c11-6-3-7-9(14-4-6)16(10(18)15-7)1-2-17-5-8(12)13/h3-4,8H,1-2,5H2,(H,15,18).
What are the key properties of 6-bromo-3-[2-(2,2-difluoroethoxy)ethyl]-1H-imidazo[4,5-b]pyridine-2-thione?
6-bromo-3-[2-(2,2-difluoroethoxy)ethyl]-1H-imidazo[4,5-b]pyridine-2-thione has a molecular weight of 338.18 g/mol, XLogP of 3.14, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-3-[2-(2,2-difluoroethoxy)ethyl]-1H-imidazo[4,5-b]pyridine-2-thione is sourced from PubChem (CID 114126816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).