C10H18F2N4O2 — CID 114126859
3-[4-[[2-(2,2-difluoroethoxy)ethylamino]methyl]triazol-1-yl]propan-1-ol (PubChem CID 114126859) has the molecular formula C10H18F2N4O2 and a molecular weight of 264.28 g/mol. Its IUPAC name is 3-[4-[[2-(2,2-difluoroethoxy)ethylamino]methyl]triazol-1-yl]propan-1-ol.
| Compound Name | 3-[4-[[2-(2,2-difluoroethoxy)ethylamino]methyl]triazol-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 114126859 |
| Molecular Formula | C10H18F2N4O2 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 3-[4-[[2-(2,2-difluoroethoxy)ethylamino]methyl]triazol-1-yl]propan-1-ol |
| SMILES | OCCCn1cc(CNCCOCC(F)F)nn1 |
| InChI | InChI=1S/C10H18F2N4O2/c11-10(12)8-18-5-2-13-6-9-7-16(15-14-9)3-1-4-17/h7,10,13,17H,1-6,8H2 |
| InChIKey | ABHGKXDCNCSHDS-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|