C14H30N2O2 — CID 114126917
[1-[[2-[2-(dimethylamino)ethoxy]ethylamino]methyl]cyclohexyl]methanol (PubChem CID 114126917) has the molecular formula C14H30N2O2 and a molecular weight of 258.41 g/mol. Its IUPAC name is [1-[[2-[2-(dimethylamino)ethoxy]ethylamino]methyl]cyclohexyl]methanol.
| Compound Name | [1-[[2-[2-(dimethylamino)ethoxy]ethylamino]methyl]cyclohexyl]methanol |
|---|---|
| PubChem CID | 114126917 |
| Molecular Formula | C14H30N2O2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.23 |
| IUPAC Name | [1-[[2-[2-(dimethylamino)ethoxy]ethylamino]methyl]cyclohexyl]methanol |
| SMILES | CN(C)CCOCCNCC1(CO)CCCCC1 |
| InChI | InChI=1S/C14H30N2O2/c1-16(2)9-11-18-10-8-15-12-14(13-17)6-4-3-5-7-14/h15,17H,3-13H2,1-2H3 |
| InChIKey | NOUOWWBZSXXZJN-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|