About phenyl prop-2-enyl carbonate
phenyl prop-2-enyl carbonate (PubChem CID 11412694) has the molecular formula C10H10O3
and a molecular weight of 178.19 g/mol. Its IUPAC name is phenyl prop-2-enyl carbonate.
Molecular Properties
| Compound Name | phenyl prop-2-enyl carbonate |
| PubChem CID | 11412694 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | phenyl prop-2-enyl carbonate |
| SMILES | C=CCOC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C10H10O3/c1-2-8-12-10(11)13-9-6-4-3-5-7-9/h2-7H,1,8H2 |
| InChIKey | ORUWSEKEVGOAQR-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze phenyl prop-2-enyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl prop-2-enyl carbonate?
The IUPAC name of phenyl prop-2-enyl carbonate (CID 11412694) is phenyl prop-2-enyl carbonate.
What is the SMILES notation for phenyl prop-2-enyl carbonate?
The canonical SMILES for phenyl prop-2-enyl carbonate is C=CCOC(=O)Oc1ccccc1.
What is the InChIKey of phenyl prop-2-enyl carbonate?
The InChIKey is ORUWSEKEVGOAQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O3/c1-2-8-12-10(11)13-9-6-4-3-5-7-9/h2-7H,1,8H2.
What are the key properties of phenyl prop-2-enyl carbonate?
phenyl prop-2-enyl carbonate has a molecular weight of 178.19 g/mol, XLogP of 2.39, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl prop-2-enyl carbonate is sourced from PubChem (CID 11412694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).