About N-[(Z)-1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-yl]-2-methylpropan-1-amine
N-[(Z)-1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-yl]-2-methylpropan-1-amine (PubChem CID 11412728) has the molecular formula C11H20N2
and a molecular weight of 180.30 g/mol. Its IUPAC name is N-[(Z)-1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-yl]-2-methylpropan-1-amine.
Molecular Properties
| Compound Name | N-[(Z)-1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-yl]-2-methylpropan-1-amine |
| PubChem CID | 11412728 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.30 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | N-[(Z)-1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-yl]-2-methylpropan-1-amine |
| SMILES | C/C(=C/C1=NCCC1)NCC(C)C |
| InChI | InChI=1S/C11H20N2/c1-9(2)8-13-10(3)7-11-5-4-6-12-11/h7,9,13H,4-6,8H2,1-3H3/b10-7- |
| InChIKey | RQQMVOZKWSNAPQ-YFHOEESVSA-N |
| XLogP | 2.37 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(Z)-1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-yl]-2-methylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-yl]-2-methylpropan-1-amine?
The IUPAC name of N-[(Z)-1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-yl]-2-methylpropan-1-amine (CID 11412728) is N-[(Z)-1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-yl]-2-methylpropan-1-amine.
What is the SMILES notation for N-[(Z)-1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-yl]-2-methylpropan-1-amine?
The canonical SMILES for N-[(Z)-1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-yl]-2-methylpropan-1-amine is C/C(=C/C1=NCCC1)NCC(C)C.
What is the InChIKey of N-[(Z)-1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-yl]-2-methylpropan-1-amine?
The InChIKey is RQQMVOZKWSNAPQ-YFHOEESVSA-N. The full InChI is InChI=1S/C11H20N2/c1-9(2)8-13-10(3)7-11-5-4-6-12-11/h7,9,13H,4-6,8H2,1-3H3/b10-7-.
What are the key properties of N-[(Z)-1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-yl]-2-methylpropan-1-amine?
N-[(Z)-1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-yl]-2-methylpropan-1-amine has a molecular weight of 180.30 g/mol, XLogP of 2.37, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-yl]-2-methylpropan-1-amine is sourced from PubChem (CID 11412728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).