About 2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine
2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine (PubChem CID 11412747) has the molecular formula C7H6N2S2
and a molecular weight of 182.27 g/mol. Its IUPAC name is 2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine.
Molecular Properties
| Compound Name | 2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine |
| PubChem CID | 11412747 |
| Molecular Formula | C7H6N2S2 |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.00 |
| IUPAC Name | 2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine |
| SMILES | CSc1nc2ncccc2s1 |
| InChI | InChI=1S/C7H6N2S2/c1-10-7-9-6-5(11-7)3-2-4-8-6/h2-4H,1H3 |
| InChIKey | XNPFLEICSMQHLM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine?
The IUPAC name of 2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine (CID 11412747) is 2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine.
What is the SMILES notation for 2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine?
The canonical SMILES for 2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine is CSc1nc2ncccc2s1.
What is the InChIKey of 2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine?
The InChIKey is XNPFLEICSMQHLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2S2/c1-10-7-9-6-5(11-7)3-2-4-8-6/h2-4H,1H3.
What are the key properties of 2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine?
2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine has a molecular weight of 182.27 g/mol, XLogP of 2.41, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine is sourced from PubChem (CID 11412747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).