About 3-[2-(2,2-difluoroethoxy)ethylamino]-1-propan-2-ylpyrazin-2-one
3-[2-(2,2-difluoroethoxy)ethylamino]-1-propan-2-ylpyrazin-2-one (PubChem CID 114127782) has the molecular formula C11H17F2N3O2
and a molecular weight of 261.27 g/mol. Its IUPAC name is 3-[2-(2,2-difluoroethoxy)ethylamino]-1-propan-2-ylpyrazin-2-one.
Molecular Properties
| Compound Name | 3-[2-(2,2-difluoroethoxy)ethylamino]-1-propan-2-ylpyrazin-2-one |
| PubChem CID | 114127782 |
| Molecular Formula | C11H17F2N3O2 |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 3-[2-(2,2-difluoroethoxy)ethylamino]-1-propan-2-ylpyrazin-2-one |
| SMILES | CC(C)n1ccnc(NCCOCC(F)F)c1=O |
| InChI | InChI=1S/C11H17F2N3O2/c1-8(2)16-5-3-14-10(11(16)17)15-4-6-18-7-9(12)13/h3,5,8-9H,4,6-7H2,1-2H3,(H,14,15) |
| InChIKey | PGOKOIULDDGVSR-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(2,2-difluoroethoxy)ethylamino]-1-propan-2-ylpyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(2,2-difluoroethoxy)ethylamino]-1-propan-2-ylpyrazin-2-one?
The IUPAC name of 3-[2-(2,2-difluoroethoxy)ethylamino]-1-propan-2-ylpyrazin-2-one (CID 114127782) is 3-[2-(2,2-difluoroethoxy)ethylamino]-1-propan-2-ylpyrazin-2-one.
What is the SMILES notation for 3-[2-(2,2-difluoroethoxy)ethylamino]-1-propan-2-ylpyrazin-2-one?
The canonical SMILES for 3-[2-(2,2-difluoroethoxy)ethylamino]-1-propan-2-ylpyrazin-2-one is CC(C)n1ccnc(NCCOCC(F)F)c1=O.
What is the InChIKey of 3-[2-(2,2-difluoroethoxy)ethylamino]-1-propan-2-ylpyrazin-2-one?
The InChIKey is PGOKOIULDDGVSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F2N3O2/c1-8(2)16-5-3-14-10(11(16)17)15-4-6-18-7-9(12)13/h3,5,8-9H,4,6-7H2,1-2H3,(H,14,15).
What are the key properties of 3-[2-(2,2-difluoroethoxy)ethylamino]-1-propan-2-ylpyrazin-2-one?
3-[2-(2,2-difluoroethoxy)ethylamino]-1-propan-2-ylpyrazin-2-one has a molecular weight of 261.27 g/mol, XLogP of 1.52, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(2,2-difluoroethoxy)ethylamino]-1-propan-2-ylpyrazin-2-one is sourced from PubChem (CID 114127782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).