About 3-[2-(2,2-difluoroethoxy)ethylamino]pyrazine-2-carbothioamide
3-[2-(2,2-difluoroethoxy)ethylamino]pyrazine-2-carbothioamide (PubChem CID 114127808) has the molecular formula C9H12F2N4OS
and a molecular weight of 262.28 g/mol. Its IUPAC name is 3-[2-(2,2-difluoroethoxy)ethylamino]pyrazine-2-carbothioamide.
Molecular Properties
| Compound Name | 3-[2-(2,2-difluoroethoxy)ethylamino]pyrazine-2-carbothioamide |
| PubChem CID | 114127808 |
| Molecular Formula | C9H12F2N4OS |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 3-[2-(2,2-difluoroethoxy)ethylamino]pyrazine-2-carbothioamide |
| SMILES | NC(=S)c1nccnc1NCCOCC(F)F |
| InChI | InChI=1S/C9H12F2N4OS/c10-6(11)5-16-4-3-15-9-7(8(12)17)13-1-2-14-9/h1-2,6H,3-5H2,(H2,12,17)(H,14,15) |
| InChIKey | SNSFRLNLOADWCG-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(2,2-difluoroethoxy)ethylamino]pyrazine-2-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(2,2-difluoroethoxy)ethylamino]pyrazine-2-carbothioamide?
The IUPAC name of 3-[2-(2,2-difluoroethoxy)ethylamino]pyrazine-2-carbothioamide (CID 114127808) is 3-[2-(2,2-difluoroethoxy)ethylamino]pyrazine-2-carbothioamide.
What is the SMILES notation for 3-[2-(2,2-difluoroethoxy)ethylamino]pyrazine-2-carbothioamide?
The canonical SMILES for 3-[2-(2,2-difluoroethoxy)ethylamino]pyrazine-2-carbothioamide is NC(=S)c1nccnc1NCCOCC(F)F.
What is the InChIKey of 3-[2-(2,2-difluoroethoxy)ethylamino]pyrazine-2-carbothioamide?
The InChIKey is SNSFRLNLOADWCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F2N4OS/c10-6(11)5-16-4-3-15-9-7(8(12)17)13-1-2-14-9/h1-2,6H,3-5H2,(H2,12,17)(H,14,15).
What are the key properties of 3-[2-(2,2-difluoroethoxy)ethylamino]pyrazine-2-carbothioamide?
3-[2-(2,2-difluoroethoxy)ethylamino]pyrazine-2-carbothioamide has a molecular weight of 262.28 g/mol, XLogP of 0.80, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(2,2-difluoroethoxy)ethylamino]pyrazine-2-carbothioamide is sourced from PubChem (CID 114127808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).