C12H24F2N2O — CID 114127972
1-[2-(2,2-difluoroethoxy)ethyl]-3-propan-2-yl-1,4-diazepane (PubChem CID 114127972) has the molecular formula C12H24F2N2O and a molecular weight of 250.33 g/mol. Its IUPAC name is 1-[2-(2,2-difluoroethoxy)ethyl]-3-propan-2-yl-1,4-diazepane.
| Compound Name | 1-[2-(2,2-difluoroethoxy)ethyl]-3-propan-2-yl-1,4-diazepane |
|---|---|
| PubChem CID | 114127972 |
| Molecular Formula | C12H24F2N2O |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 1-[2-(2,2-difluoroethoxy)ethyl]-3-propan-2-yl-1,4-diazepane |
| SMILES | CC(C)C1CN(CCOCC(F)F)CCCN1 |
| InChI | InChI=1S/C12H24F2N2O/c1-10(2)11-8-16(5-3-4-15-11)6-7-17-9-12(13)14/h10-12,15H,3-9H2,1-2H3 |
| InChIKey | CEDBXVVNSXTFHK-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|